About dibutyl 2-(2-oxopropyl)propanedioate
dibutyl 2-(2-oxopropyl)propanedioate (PubChem CID 130210122) has the molecular formula C14H24O5
and a molecular weight of 272.34 g/mol. Its IUPAC name is dibutyl 2-(2-oxopropyl)propanedioate.
Molecular Properties
| Compound Name | dibutyl 2-(2-oxopropyl)propanedioate |
| PubChem CID | 130210122 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | dibutyl 2-(2-oxopropyl)propanedioate |
| SMILES | CCCCOC(=O)C(CC(C)=O)C(=O)OCCCC |
| InChI | InChI=1S/C14H24O5/c1-4-6-8-18-13(16)12(10-11(3)15)14(17)19-9-7-5-2/h12H,4-10H2,1-3H3 |
| InChIKey | PCJVLWVXYHRDLI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dibutyl 2-(2-oxopropyl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyl 2-(2-oxopropyl)propanedioate?
The IUPAC name of dibutyl 2-(2-oxopropyl)propanedioate (CID 130210122) is dibutyl 2-(2-oxopropyl)propanedioate.
What is the SMILES notation for dibutyl 2-(2-oxopropyl)propanedioate?
The canonical SMILES for dibutyl 2-(2-oxopropyl)propanedioate is CCCCOC(=O)C(CC(C)=O)C(=O)OCCCC.
What is the InChIKey of dibutyl 2-(2-oxopropyl)propanedioate?
The InChIKey is PCJVLWVXYHRDLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O5/c1-4-6-8-18-13(16)12(10-11(3)15)14(17)19-9-7-5-2/h12H,4-10H2,1-3H3.
What are the key properties of dibutyl 2-(2-oxopropyl)propanedioate?
dibutyl 2-(2-oxopropyl)propanedioate has a molecular weight of 272.34 g/mol, XLogP of 2.27, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl 2-(2-oxopropyl)propanedioate is sourced from PubChem (CID 130210122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).