C13H20ClNO — CID 13021160
2-chloro-N-prop-2-enyl-N-(3,3,5-trimethylcyclopenten-1-yl)acetamide (PubChem CID 13021160) has the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. Its IUPAC name is 2-chloro-N-prop-2-enyl-N-(3,3,5-trimethylcyclopenten-1-yl)acetamide.
| Compound Name | 2-chloro-N-prop-2-enyl-N-(3,3,5-trimethylcyclopenten-1-yl)acetamide |
|---|---|
| PubChem CID | 13021160 |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 241.76 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-chloro-N-prop-2-enyl-N-(3,3,5-trimethylcyclopenten-1-yl)acetamide |
| SMILES | C=CCN(C(=O)CCl)C1=CC(C)(C)CC1C |
| InChI | InChI=1S/C13H20ClNO/c1-5-6-15(12(16)9-14)11-8-13(3,4)7-10(11)2/h5,8,10H,1,6-7,9H2,2-4H3 |
| InChIKey | XTECRDGYNUGHEP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.76 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|