C42H32S2 — CID 130212871
(16E)-16-[(E)-3-[10-[(2E,4Z)-hexa-2,4-dien-2-yl]anthracen-9-yl]but-2-enylidene]-9,15-dithiapentacyclo[11.7.0.02,10.03,8.014,18]icosa-1(13),2(10),3,5,7,11,14(18),19-octaene (PubChem CID 130212871) has the molecular formula C42H32S2 and a molecular weight of 600.85 g/mol. Its IUPAC name is (16E)-16-[(E)-3-[10-[(2E,4Z)-hexa-2,4-dien-2-yl]anthracen-9-yl]but-2-enylidene]-9,15-dithiapentacyclo[11.7.0.02,10.03,8.014,18]icosa-1(13),2(10),3,5,7,11,14(18),19-octaene.
| Compound Name | (16E)-16-[(E)-3-[10-[(2E,4Z)-hexa-2,4-dien-2-yl]anthracen-9-yl]but-2-enylidene]-9,15-dithiapentacyclo[11.7.0.02,10.03,8.014,18]icosa-1(13),2(10),3,5,7,11,14(18),19-octaene |
|---|---|
| PubChem CID | 130212871 |
| Molecular Formula | C42H32S2 |
| Molecular Weight | 600.85 g/mol |
| Exact Mass | 600.19 |
| IUPAC Name | (16E)-16-[(E)-3-[10-[(2E,4Z)-hexa-2,4-dien-2-yl]anthracen-9-yl]but-2-enylidene]-9,15-dithiapentacyclo[11.7.0.02,10.03,8.014,18]icosa-1(13),2(10),3,5,7,11,14(18),19-octaene |
| SMILES | C/C=C\C=C(/C)c1c2ccccc2c(/C(C)=C/C=C2\Cc3ccc4c(ccc5sc6ccccc6c54)c3S2)c2ccccc12 |
| InChI | InChI=1S/C42H32S2/c1-4-5-12-26(2)39-30-13-6-8-15-32(30)40(33-16-9-7-14-31(33)39)27(3)19-21-29-25-28-20-22-34-35(42(28)43-29)23-24-38-41(34)36-17-10-11-18-37(36)44-38/h4-24H,25H2,1-3H3/b5-4-,26-12+,27-19+,29-21+ |
| InChIKey | SGAQGXSKSHZCIX-BCIFIQLSSA-N |
| XLogP | 13.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.85 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|