C12H12ClN5 — CID 130215667
2-chloro-N-methyl-N-phenyl-8,9-dihydro-7H-purin-6-amine (PubChem CID 130215667) has the molecular formula C12H12ClN5 and a molecular weight of 261.72 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-phenyl-8,9-dihydro-7H-purin-6-amine.
| Compound Name | 2-chloro-N-methyl-N-phenyl-8,9-dihydro-7H-purin-6-amine |
|---|---|
| PubChem CID | 130215667 |
| Molecular Formula | C12H12ClN5 |
| Molecular Weight | 261.72 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-chloro-N-methyl-N-phenyl-8,9-dihydro-7H-purin-6-amine |
| SMILES | CN(c1ccccc1)c1nc(Cl)nc2c1NCN2 |
| InChI | InChI=1S/C12H12ClN5/c1-18(8-5-3-2-4-6-8)11-9-10(15-7-14-9)16-12(13)17-11/h2-6,14H,7H2,1H3,(H,15,16,17) |
| InChIKey | DHLPBJJKXQIXLV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.72 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |