C10H8Cl2N4 — CID 130391718
1-(2,5-dichloropyrimidin-4-yl)-1-phenylhydrazine (PubChem CID 130391718) has the molecular formula C10H8Cl2N4 and a molecular weight of 255.11 g/mol. Its IUPAC name is 1-(2,5-dichloropyrimidin-4-yl)-1-phenylhydrazine.
| Compound Name | 1-(2,5-dichloropyrimidin-4-yl)-1-phenylhydrazine |
|---|---|
| PubChem CID | 130391718 |
| Molecular Formula | C10H8Cl2N4 |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 1-(2,5-dichloropyrimidin-4-yl)-1-phenylhydrazine |
| SMILES | NN(c1ccccc1)c1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C10H8Cl2N4/c11-8-6-14-10(12)15-9(8)16(13)7-4-2-1-3-5-7/h1-6H,13H2 |
| InChIKey | SDGQLPQBSKNMPH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|