C9H11Cl2N3O — CID 82748113
2,5-dichloro-N-methyl-N-(oxolan-3-yl)pyrimidin-4-amine (PubChem CID 82748113) has the molecular formula C9H11Cl2N3O and a molecular weight of 248.11 g/mol. Its IUPAC name is 2,5-dichloro-N-methyl-N-(oxolan-3-yl)pyrimidin-4-amine.
| Compound Name | 2,5-dichloro-N-methyl-N-(oxolan-3-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 82748113 |
| Molecular Formula | C9H11Cl2N3O |
| Molecular Weight | 248.11 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 2,5-dichloro-N-methyl-N-(oxolan-3-yl)pyrimidin-4-amine |
| SMILES | CN(c1nc(Cl)ncc1Cl)C1CCOC1 |
| InChI | InChI=1S/C9H11Cl2N3O/c1-14(6-2-3-15-5-6)8-7(10)4-12-9(11)13-8/h4,6H,2-3,5H2,1H3 |
| InChIKey | PPSFDUZDUIBBMT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.11 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |