C15H20FNO — CID 130216716
(E)-1-[4-[(3E,5E)-6-fluorohexa-1,3,5-trien-3-yl]piperidin-1-yl]but-2-en-1-one (PubChem CID 130216716) has the molecular formula C15H20FNO and a molecular weight of 249.33 g/mol. Its IUPAC name is (E)-1-[4-[(3E,5E)-6-fluorohexa-1,3,5-trien-3-yl]piperidin-1-yl]but-2-en-1-one.
| Compound Name | (E)-1-[4-[(3E,5E)-6-fluorohexa-1,3,5-trien-3-yl]piperidin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 130216716 |
| Molecular Formula | C15H20FNO |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (E)-1-[4-[(3E,5E)-6-fluorohexa-1,3,5-trien-3-yl]piperidin-1-yl]but-2-en-1-one |
| SMILES | C=C/C(=C\C=C\F)C1CCN(C(=O)/C=C/C)CC1 |
| InChI | InChI=1S/C15H20FNO/c1-3-6-15(18)17-11-8-14(9-12-17)13(4-2)7-5-10-16/h3-7,10,14H,2,8-9,11-12H2,1H3/b6-3+,10-5+,13-7+ |
| InChIKey | SKFHWFRCVBBEFN-SZALHVSLSA-N |
| XLogP | 3.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|