C17H27NO — CID 44561415
(2E,4E)-5,9-dimethyl-1-piperidin-1-yldeca-2,4,8-trien-1-one (PubChem CID 44561415) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is (2E,4E)-5,9-dimethyl-1-piperidin-1-yldeca-2,4,8-trien-1-one.
| Compound Name | (2E,4E)-5,9-dimethyl-1-piperidin-1-yldeca-2,4,8-trien-1-one |
|---|---|
| PubChem CID | 44561415 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | (2E,4E)-5,9-dimethyl-1-piperidin-1-yldeca-2,4,8-trien-1-one |
| SMILES | CC(C)=CCC/C(C)=C/C=C/C(=O)N1CCCCC1 |
| InChI | InChI=1S/C17H27NO/c1-15(2)9-7-10-16(3)11-8-12-17(19)18-13-5-4-6-14-18/h8-9,11-12H,4-7,10,13-14H2,1-3H3/b12-8+,16-11+ |
| InChIKey | UQQYVCLEAYOHDN-VVROIFTPSA-N |
| XLogP | 4.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|