C25H43NO — CID 101634668
Pipereicosalidine (PubChem CID 101634668) has the molecular formula C25H43NO and a molecular weight of 373.60 g/mol. Its IUPAC name is (2E,4E,16Z)-1-piperidin-1-ylicosa-2,4,16-trien-1-one.
| Compound Name | Pipereicosalidine |
|---|---|
| PubChem CID | 101634668 |
| Molecular Formula | C25H43NO |
| Molecular Weight | 373.60 g/mol |
| Exact Mass | 373.33 |
| IUPAC Name | (2E,4E,16Z)-1-piperidin-1-ylicosa-2,4,16-trien-1-one |
| SMILES | CCC/C=C\CCCCCCCCCC/C=C/C=C/C(=O)N1CCCCC1 |
| InChI | InChI=1S/C25H43NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-22-25(27)26-23-20-18-21-24-26/h4-5,16-17,19,22H,2-3,6-15,18,20-21,23-24H2,1H3/b5-4-,17-16+,22-19+ |
| InChIKey | MKEWSYYOWWKTAK-AEPHKGLBSA-N |
| XLogP | 8.60 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | 430 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.60 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|