C16H27NO — CID 10999431
(2E,4E)-1-pyrrolidin-1-yldodeca-2,4-dien-1-one (PubChem CID 10999431) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is (2E,4E)-1-pyrrolidin-1-yldodeca-2,4-dien-1-one.
| Compound Name | (2E,4E)-1-pyrrolidin-1-yldodeca-2,4-dien-1-one |
|---|---|
| PubChem CID | 10999431 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | (2E,4E)-1-pyrrolidin-1-yldodeca-2,4-dien-1-one |
| SMILES | CCCCCCC/C=C/C=C/C(=O)N1CCCC1 |
| InChI | InChI=1S/C16H27NO/c1-2-3-4-5-6-7-8-9-10-13-16(18)17-14-11-12-15-17/h8-10,13H,2-7,11-12,14-15H2,1H3/b9-8+,13-10+ |
| InChIKey | UAIYHWLHQSKQLW-PEGOPYGQSA-N |
| XLogP | 4.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|