C22H37NO2 — CID 45483976
1-[(Z)-octadec-9-enyl]pyrrole-2,5-dione (PubChem CID 45483976) has the molecular formula C22H37NO2 and a molecular weight of 347.54 g/mol. Its IUPAC name is 1-[(Z)-octadec-9-enyl]pyrrole-2,5-dione.
| Compound Name | 1-[(Z)-octadec-9-enyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 45483976 |
| Molecular Formula | C22H37NO2 |
| Molecular Weight | 347.54 g/mol |
| Exact Mass | 347.28 |
| IUPAC Name | 1-[(Z)-octadec-9-enyl]pyrrole-2,5-dione |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C22H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-23-21(24)18-19-22(23)25/h9-10,18-19H,2-8,11-17,20H2,1H3/b10-9- |
| InChIKey | ZHLBWRSSJDVQPY-KTKRTIGZSA-N |
| XLogP | 5.95 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.54 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|