About CID 130216778
CID 130216778 (PubChem CID 130216778) has the molecular formula C5H10NOS2-
and a molecular weight of 164.27 g/mol.
Molecular Properties
| Compound Name | CID 130216778 |
| PubChem CID | 130216778 |
| Molecular Formula | C5H10NOS2- |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | — |
| SMILES | O=[S-](=S)CNC1CCC1 |
| InChI | InChI=1S/C5H10NOS2/c7-9(8)4-6-5-2-1-3-5/h5-6H,1-4H2/q-1 |
| InChIKey | ZXYMZFQJLWGBFD-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 130216778 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 130216778?
The IUPAC name of CID 130216778 (CID 130216778) is not available.
What is the SMILES notation for CID 130216778?
The canonical SMILES for CID 130216778 is O=[S-](=S)CNC1CCC1.
What is the InChIKey of CID 130216778?
The InChIKey is ZXYMZFQJLWGBFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10NOS2/c7-9(8)4-6-5-2-1-3-5/h5-6H,1-4H2/q-1.
What are the key properties of CID 130216778?
CID 130216778 has a molecular weight of 164.27 g/mol, XLogP of 0.51, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 130216778 is sourced from PubChem (CID 130216778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).