About (3S)-3-ethyl-2-propyl-2,3-dihydropyridine
(3S)-3-ethyl-2-propyl-2,3-dihydropyridine (PubChem CID 130217134) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is (3S)-3-ethyl-2-propyl-2,3-dihydropyridine.
Molecular Properties
| Compound Name | (3S)-3-ethyl-2-propyl-2,3-dihydropyridine |
| PubChem CID | 130217134 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (3S)-3-ethyl-2-propyl-2,3-dihydropyridine |
| SMILES | CCCC1N=CC=C[C@@H]1CC |
| InChI | InChI=1S/C10H17N/c1-3-6-10-9(4-2)7-5-8-11-10/h5,7-10H,3-4,6H2,1-2H3/t9-,10?/m0/s1 |
| InChIKey | VRNWSFXYVASEMP-RGURZIINSA-N |
| XLogP | 2.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S)-3-ethyl-2-propyl-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-ethyl-2-propyl-2,3-dihydropyridine?
The IUPAC name of (3S)-3-ethyl-2-propyl-2,3-dihydropyridine (CID 130217134) is (3S)-3-ethyl-2-propyl-2,3-dihydropyridine.
What is the SMILES notation for (3S)-3-ethyl-2-propyl-2,3-dihydropyridine?
The canonical SMILES for (3S)-3-ethyl-2-propyl-2,3-dihydropyridine is CCCC1N=CC=C[C@@H]1CC.
What is the InChIKey of (3S)-3-ethyl-2-propyl-2,3-dihydropyridine?
The InChIKey is VRNWSFXYVASEMP-RGURZIINSA-N. The full InChI is InChI=1S/C10H17N/c1-3-6-10-9(4-2)7-5-8-11-10/h5,7-10H,3-4,6H2,1-2H3/t9-,10?/m0/s1.
What are the key properties of (3S)-3-ethyl-2-propyl-2,3-dihydropyridine?
(3S)-3-ethyl-2-propyl-2,3-dihydropyridine has a molecular weight of 151.25 g/mol, XLogP of 2.82, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-ethyl-2-propyl-2,3-dihydropyridine is sourced from PubChem (CID 130217134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).