C10H16N2O — CID 130218186
N-butyl-3,4-dihydropyridine-3-carboxamide (PubChem CID 130218186) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is N-butyl-3,4-dihydropyridine-3-carboxamide.
| Compound Name | N-butyl-3,4-dihydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 130218186 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | N-butyl-3,4-dihydropyridine-3-carboxamide |
| SMILES | CCCCNC(=O)C1C=NC=CC1 |
| InChI | InChI=1S/C10H16N2O/c1-2-3-7-12-10(13)9-5-4-6-11-8-9/h4,6,8-9H,2-3,5,7H2,1H3,(H,12,13) |
| InChIKey | XQWVWKZYPJMMRI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|