2,5-dichloro-3-fluoro-4-(hydroxymethyl)benzoic acid

C8H5Cl2FO3 — CID 130219312

IUPAC2,5-dichloro-3-fluoro-4-(hydroxymethyl)benzoic acid
SMILESO=C(O)c1cc(Cl)c(CO)c(F)c1Cl
InChIInChI=1S/C8H5Cl2FO3/c9-5-1-3(8(13)14)6(10)7(11)4(5)2-12/h1,12H,2H2,(H,13,14)
InChIKeyQRVBLFQSLXWJCG-UHFFFAOYSA-N
MW239.03 g/mol
LogP2.32
Rot. Bonds2

About 2,5-dichloro-3-fluoro-4-(hydroxymethyl)benzoic acid

2,5-dichloro-3-fluoro-4-(hydroxymethyl)benzoic acid (PubChem CID 130219312) has the molecular formula C8H5Cl2FO3 and a molecular weight of 239.03 g/mol. Its IUPAC name is 2,5-dichloro-3-fluoro-4-(hydroxymethyl)benzoic acid.

Molecular Properties

Compound Name2,5-dichloro-3-fluoro-4-(hydroxymethyl)benzoic acid
PubChem CID130219312
Molecular FormulaC8H5Cl2FO3
Molecular Weight239.03 g/mol
Exact Mass237.96
IUPAC Name2,5-dichloro-3-fluoro-4-(hydroxymethyl)benzoic acid
SMILESO=C(O)c1cc(Cl)c(CO)c(F)c1Cl
InChIInChI=1S/C8H5Cl2FO3/c9-5-1-3(8(13)14)6(10)7(11)4(5)2-12/h1,12H,2H2,(H,13,14)
InChIKeyQRVBLFQSLXWJCG-UHFFFAOYSA-N
XLogP2.32
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.03
LogP ≤ 52.32
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 2,5-dichloro-3-fluoro-4-(hydroxymethyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-dichloro-3-fluoro-4-(hydroxymethyl)benzoic acid?
The IUPAC name of 2,5-dichloro-3-fluoro-4-(hydroxymethyl)benzoic acid (CID 130219312) is 2,5-dichloro-3-fluoro-4-(hydroxymethyl)benzoic acid.
What is the SMILES notation for 2,5-dichloro-3-fluoro-4-(hydroxymethyl)benzoic acid?
The canonical SMILES for 2,5-dichloro-3-fluoro-4-(hydroxymethyl)benzoic acid is O=C(O)c1cc(Cl)c(CO)c(F)c1Cl.
What is the InChIKey of 2,5-dichloro-3-fluoro-4-(hydroxymethyl)benzoic acid?
The InChIKey is QRVBLFQSLXWJCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Cl2FO3/c9-5-1-3(8(13)14)6(10)7(11)4(5)2-12/h1,12H,2H2,(H,13,14).
What are the key properties of 2,5-dichloro-3-fluoro-4-(hydroxymethyl)benzoic acid?
2,5-dichloro-3-fluoro-4-(hydroxymethyl)benzoic acid has a molecular weight of 239.03 g/mol, XLogP of 2.32, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichloro-3-fluoro-4-(hydroxymethyl)benzoic acid is sourced from PubChem (CID 130219312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).