C13H4Cl2F6O2 — CID 159393179
1-chloro-2,3,4-trifluorobenzene;2-chloro-3,4,5-trifluorobenzoic acid (PubChem CID 159393179) has the molecular formula C13H4Cl2F6O2 and a molecular weight of 377.07 g/mol. Its IUPAC name is 1-chloro-2,3,4-trifluorobenzene;2-chloro-3,4,5-trifluorobenzoic acid.
| Compound Name | 1-chloro-2,3,4-trifluorobenzene;2-chloro-3,4,5-trifluorobenzoic acid |
|---|---|
| PubChem CID | 159393179 |
| Molecular Formula | C13H4Cl2F6O2 |
| Molecular Weight | 377.07 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | 1-chloro-2,3,4-trifluorobenzene;2-chloro-3,4,5-trifluorobenzoic acid |
| SMILES | Fc1ccc(Cl)c(F)c1F.O=C(O)c1cc(F)c(F)c(F)c1Cl |
| InChI | InChI=1S/C7H2ClF3O2.C6H2ClF3/c8-4-2(7(12)13)1-3(9)5(10)6(4)11;7-3-1-2-4(8)6(10)5(3)9/h1H,(H,12,13);1-2H |
| InChIKey | LMJPCLUXAOECEO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.07 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|