About 2-hydroxypropyl 2-(2-phenylethoxy)ethyl carbonate
2-hydroxypropyl 2-(2-phenylethoxy)ethyl carbonate (PubChem CID 130220835) has the molecular formula C14H20O5
and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-hydroxypropyl 2-(2-phenylethoxy)ethyl carbonate.
Molecular Properties
| Compound Name | 2-hydroxypropyl 2-(2-phenylethoxy)ethyl carbonate |
| PubChem CID | 130220835 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-hydroxypropyl 2-(2-phenylethoxy)ethyl carbonate |
| SMILES | CC(O)COC(=O)OCCOCCc1ccccc1 |
| InChI | InChI=1S/C14H20O5/c1-12(15)11-19-14(16)18-10-9-17-8-7-13-5-3-2-4-6-13/h2-6,12,15H,7-11H2,1H3 |
| InChIKey | NYRFQOKJRQGTOH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropyl 2-(2-phenylethoxy)ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropyl 2-(2-phenylethoxy)ethyl carbonate?
The IUPAC name of 2-hydroxypropyl 2-(2-phenylethoxy)ethyl carbonate (CID 130220835) is 2-hydroxypropyl 2-(2-phenylethoxy)ethyl carbonate.
What is the SMILES notation for 2-hydroxypropyl 2-(2-phenylethoxy)ethyl carbonate?
The canonical SMILES for 2-hydroxypropyl 2-(2-phenylethoxy)ethyl carbonate is CC(O)COC(=O)OCCOCCc1ccccc1.
What is the InChIKey of 2-hydroxypropyl 2-(2-phenylethoxy)ethyl carbonate?
The InChIKey is NYRFQOKJRQGTOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O5/c1-12(15)11-19-14(16)18-10-9-17-8-7-13-5-3-2-4-6-13/h2-6,12,15H,7-11H2,1H3.
What are the key properties of 2-hydroxypropyl 2-(2-phenylethoxy)ethyl carbonate?
2-hydroxypropyl 2-(2-phenylethoxy)ethyl carbonate has a molecular weight of 268.31 g/mol, XLogP of 1.78, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropyl 2-(2-phenylethoxy)ethyl carbonate is sourced from PubChem (CID 130220835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).