About ethoxymethyl 2-phenylethyl carbonate
ethoxymethyl 2-phenylethyl carbonate (PubChem CID 24976123) has the molecular formula C12H16O4
and a molecular weight of 224.26 g/mol. Its IUPAC name is ethoxymethyl 2-phenylethyl carbonate.
Molecular Properties
| Compound Name | ethoxymethyl 2-phenylethyl carbonate |
| PubChem CID | 24976123 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | ethoxymethyl 2-phenylethyl carbonate |
| SMILES | CCOCOC(=O)OCCc1ccccc1 |
| InChI | InChI=1S/C12H16O4/c1-2-14-10-16-12(13)15-9-8-11-6-4-3-5-7-11/h3-7H,2,8-10H2,1H3 |
| InChIKey | UFCRDQFQHWXKCT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethoxymethyl 2-phenylethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxymethyl 2-phenylethyl carbonate?
The IUPAC name of ethoxymethyl 2-phenylethyl carbonate (CID 24976123) is ethoxymethyl 2-phenylethyl carbonate.
What is the SMILES notation for ethoxymethyl 2-phenylethyl carbonate?
The canonical SMILES for ethoxymethyl 2-phenylethyl carbonate is CCOCOC(=O)OCCc1ccccc1.
What is the InChIKey of ethoxymethyl 2-phenylethyl carbonate?
The InChIKey is UFCRDQFQHWXKCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O4/c1-2-14-10-16-12(13)15-9-8-11-6-4-3-5-7-11/h3-7H,2,8-10H2,1H3.
What are the key properties of ethoxymethyl 2-phenylethyl carbonate?
ethoxymethyl 2-phenylethyl carbonate has a molecular weight of 224.26 g/mol, XLogP of 2.38, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxymethyl 2-phenylethyl carbonate is sourced from PubChem (CID 24976123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).