C9H20OSi2 — CID 13022131
1,1,2,2-tetramethyldisilepan-5-one (PubChem CID 13022131) has the molecular formula C9H20OSi2 and a molecular weight of 200.43 g/mol. Its IUPAC name is 1,1,2,2-tetramethyldisilepan-5-one.
| Compound Name | 1,1,2,2-tetramethyldisilepan-5-one |
|---|---|
| PubChem CID | 13022131 |
| Molecular Formula | C9H20OSi2 |
| Molecular Weight | 200.43 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 1,1,2,2-tetramethyldisilepan-5-one |
| SMILES | C[Si]1(C)CCC(=O)CC[Si]1(C)C |
| InChI | InChI=1S/C9H20OSi2/c1-11(2)7-5-9(10)6-8-12(11,3)4/h5-8H2,1-4H3 |
| InChIKey | JOKCOOKIZRGGGP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|