C8H13O2P — CID 13022165
1-methyl-1-oxo-2,3,4,6a-tetrahydrocyclopenta[b]phosphol-3a-ol (PubChem CID 13022165) has the molecular formula C8H13O2P and a molecular weight of 172.16 g/mol. Its IUPAC name is 1-methyl-1-oxo-2,3,4,6a-tetrahydrocyclopenta[b]phosphol-3a-ol.
| Compound Name | 1-methyl-1-oxo-2,3,4,6a-tetrahydrocyclopenta[b]phosphol-3a-ol |
|---|---|
| PubChem CID | 13022165 |
| Molecular Formula | C8H13O2P |
| Molecular Weight | 172.16 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 1-methyl-1-oxo-2,3,4,6a-tetrahydrocyclopenta[b]phosphol-3a-ol |
| SMILES | CP1(=O)CCC2(O)CC=CC21 |
| InChI | InChI=1S/C8H13O2P/c1-11(10)6-5-8(9)4-2-3-7(8)11/h2-3,7,9H,4-6H2,1H3 |
| InChIKey | DNNGOPGOIFFIIJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.16 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|