C11H17NO2 — CID 121223133
1-(4a-hydroxy-1,3,4,5,8,8a-hexahydroisoquinolin-2-yl)ethanone (PubChem CID 121223133) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 1-(4a-hydroxy-1,3,4,5,8,8a-hexahydroisoquinolin-2-yl)ethanone.
| Compound Name | 1-(4a-hydroxy-1,3,4,5,8,8a-hexahydroisoquinolin-2-yl)ethanone |
|---|---|
| PubChem CID | 121223133 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 1-(4a-hydroxy-1,3,4,5,8,8a-hexahydroisoquinolin-2-yl)ethanone |
| SMILES | CC(=O)N1CCC2(O)CC=CCC2C1 |
| InChI | InChI=1S/C11H17NO2/c1-9(13)12-7-6-11(14)5-3-2-4-10(11)8-12/h2-3,10,14H,4-8H2,1H3 |
| InChIKey | JZFDWDIEJWMAFT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|