C15H27ClO — CID 130223944
3,7,7-trimethylcycloundecane-1-carbonyl chloride (PubChem CID 130223944) has the molecular formula C15H27ClO and a molecular weight of 258.83 g/mol. Its IUPAC name is 3,7,7-trimethylcycloundecane-1-carbonyl chloride.
| Compound Name | 3,7,7-trimethylcycloundecane-1-carbonyl chloride |
|---|---|
| PubChem CID | 130223944 |
| Molecular Formula | C15H27ClO |
| Molecular Weight | 258.83 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 3,7,7-trimethylcycloundecane-1-carbonyl chloride |
| SMILES | CC1CCCC(C)(C)CCCCC(C(=O)Cl)C1 |
| InChI | InChI=1S/C15H27ClO/c1-12-7-6-10-15(2,3)9-5-4-8-13(11-12)14(16)17/h12-13H,4-11H2,1-3H3 |
| InChIKey | CKIIWTPTFGNVJZ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.83 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|