C11H13NS4 — CID 130223994
2-[1,3-bis(disulfanyl)propan-2-yl]-1H-indole (PubChem CID 130223994) has the molecular formula C11H13NS4 and a molecular weight of 287.50 g/mol. Its IUPAC name is 2-[1,3-bis(disulfanyl)propan-2-yl]-1H-indole.
| Compound Name | 2-[1,3-bis(disulfanyl)propan-2-yl]-1H-indole |
|---|---|
| PubChem CID | 130223994 |
| Molecular Formula | C11H13NS4 |
| Molecular Weight | 287.50 g/mol |
| Exact Mass | 286.99 |
| IUPAC Name | 2-[1,3-bis(disulfanyl)propan-2-yl]-1H-indole |
| SMILES | SSCC(CSS)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C11H13NS4/c13-15-6-9(7-16-14)11-5-8-3-1-2-4-10(8)12-11/h1-5,9,12-14H,6-7H2 |
| InChIKey | FVYLMCRSDPBKJU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|