C11H15N3 — CID 46184304
2-(1H-indol-2-yl)propane-1,3-diamine (PubChem CID 46184304) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-(1H-indol-2-yl)propane-1,3-diamine.
| Compound Name | 2-(1H-indol-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 46184304 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 2-(1H-indol-2-yl)propane-1,3-diamine |
| SMILES | NCC(CN)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C11H15N3/c12-6-9(7-13)11-5-8-3-1-2-4-10(8)14-11/h1-5,9,14H,6-7,12-13H2 |
| InChIKey | XWGCZYXJHMIVDY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 67.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |