C13H19N3O2 — CID 174391430
1-(3-aminopropylamino)-2-(1H-indol-2-yl)ethane-1,2-diol (PubChem CID 174391430) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 1-(3-aminopropylamino)-2-(1H-indol-2-yl)ethane-1,2-diol.
| Compound Name | 1-(3-aminopropylamino)-2-(1H-indol-2-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 174391430 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1-(3-aminopropylamino)-2-(1H-indol-2-yl)ethane-1,2-diol |
| SMILES | NCCCNC(O)C(O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C13H19N3O2/c14-6-3-7-15-13(18)12(17)11-8-9-4-1-2-5-10(9)16-11/h1-2,4-5,8,12-13,15-18H,3,6-7,14H2 |
| InChIKey | DHFOZFUMADHQJP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|