C11H17NO — CID 130224572
6-butan-2-yloxy-2,3-dimethylpyridine (PubChem CID 130224572) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 6-butan-2-yloxy-2,3-dimethylpyridine.
| Compound Name | 6-butan-2-yloxy-2,3-dimethylpyridine |
|---|---|
| PubChem CID | 130224572 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 6-butan-2-yloxy-2,3-dimethylpyridine |
| SMILES | CCC(C)Oc1ccc(C)c(C)n1 |
| InChI | InChI=1S/C11H17NO/c1-5-9(3)13-11-7-6-8(2)10(4)12-11/h6-7,9H,5H2,1-4H3 |
| InChIKey | UUZAMHIBVYUTQU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |