C20H25Cl — CID 130224575
1-[5-(3-chlorophenyl)hexan-2-yl]-2,3-dimethylbenzene (PubChem CID 130224575) has the molecular formula C20H25Cl and a molecular weight of 300.87 g/mol. Its IUPAC name is 1-[5-(3-chlorophenyl)hexan-2-yl]-2,3-dimethylbenzene.
| Compound Name | 1-[5-(3-chlorophenyl)hexan-2-yl]-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 130224575 |
| Molecular Formula | C20H25Cl |
| Molecular Weight | 300.87 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1-[5-(3-chlorophenyl)hexan-2-yl]-2,3-dimethylbenzene |
| SMILES | Cc1cccc(C(C)CCC(C)c2cccc(Cl)c2)c1C |
| InChI | InChI=1S/C20H25Cl/c1-14-7-5-10-20(17(14)4)16(3)12-11-15(2)18-8-6-9-19(21)13-18/h5-10,13,15-16H,11-12H2,1-4H3 |
| InChIKey | JAGRECHGGALTIU-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.87 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |