C13H19Cl — CID 64719009
1-(4-chloropentan-2-yl)-2,3-dimethylbenzene (PubChem CID 64719009) has the molecular formula C13H19Cl and a molecular weight of 210.75 g/mol. Its IUPAC name is 1-(4-chloropentan-2-yl)-2,3-dimethylbenzene.
| Compound Name | 1-(4-chloropentan-2-yl)-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 64719009 |
| Molecular Formula | C13H19Cl |
| Molecular Weight | 210.75 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 1-(4-chloropentan-2-yl)-2,3-dimethylbenzene |
| SMILES | Cc1cccc(C(C)CC(C)Cl)c1C |
| InChI | InChI=1S/C13H19Cl/c1-9-6-5-7-13(12(9)4)10(2)8-11(3)14/h5-7,10-11H,8H2,1-4H3 |
| InChIKey | YLLGNKSVDMTNJE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.75 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|