C24H30FN — CID 130226200
(4Z,5Z,9Z,11Z)-4-ethylidene-N-[(3-fluorophenyl)methyl]-N-methyl-8-methylidenetrideca-1,5,9,11-tetraen-2-amine (PubChem CID 130226200) has the molecular formula C24H30FN and a molecular weight of 351.51 g/mol. Its IUPAC name is (4Z,5Z,9Z,11Z)-4-ethylidene-N-[(3-fluorophenyl)methyl]-N-methyl-8-methylidenetrideca-1,5,9,11-tetraen-2-amine.
| Compound Name | (4Z,5Z,9Z,11Z)-4-ethylidene-N-[(3-fluorophenyl)methyl]-N-methyl-8-methylidenetrideca-1,5,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 130226200 |
| Molecular Formula | C24H30FN |
| Molecular Weight | 351.51 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | (4Z,5Z,9Z,11Z)-4-ethylidene-N-[(3-fluorophenyl)methyl]-N-methyl-8-methylidenetrideca-1,5,9,11-tetraen-2-amine |
| SMILES | C=C(/C=C\C=C/C)C/C=C\C(=C/C)CC(=C)N(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C24H30FN/c1-6-8-9-12-20(3)13-10-14-22(7-2)17-21(4)26(5)19-23-15-11-16-24(25)18-23/h6-12,14-16,18H,3-4,13,17,19H2,1-2,5H3/b8-6-,12-9-,14-10-,22-7+ |
| InChIKey | DBLHAPZTEWFJHX-FJMNIQJDSA-N |
| XLogP | 6.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.51 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|