C20H22FN5O3S — CID 130226638
5-[[[3-[(2S,3R,4S)-3,4-dihydroxythiolan-2-yl]imidazo[1,2-a]pyrazin-8-yl]amino]methyl]-2-fluoro-N,N-dimethylbenzamide (PubChem CID 130226638) has the molecular formula C20H22FN5O3S and a molecular weight of 431.49 g/mol. Its IUPAC name is 5-[[[3-[(2S,3R,4S)-3,4-dihydroxythiolan-2-yl]imidazo[1,2-a]pyrazin-8-yl]amino]methyl]-2-fluoro-N,N-dimethylbenzamide.
| Compound Name | 5-[[[3-[(2S,3R,4S)-3,4-dihydroxythiolan-2-yl]imidazo[1,2-a]pyrazin-8-yl]amino]methyl]-2-fluoro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 130226638 |
| Molecular Formula | C20H22FN5O3S |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 5-[[[3-[(2S,3R,4S)-3,4-dihydroxythiolan-2-yl]imidazo[1,2-a]pyrazin-8-yl]amino]methyl]-2-fluoro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cc(CNc2nccn3c([C@@H]4SC[C@@H](O)[C@H]4O)cnc23)ccc1F |
| InChI | InChI=1S/C20H22FN5O3S/c1-25(2)20(29)12-7-11(3-4-13(12)21)8-23-18-19-24-9-14(26(19)6-5-22-18)17-16(28)15(27)10-30-17/h3-7,9,15-17,27-28H,8,10H2,1-2H3,(H,22,23)/t15-,16-,17+/m1/s1 |
| InChIKey | PLXQLOYISFAQEL-ZACQAIPSSA-N |
| XLogP | 1.69 |
| TPSA | 102.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |