C12H16N4O — CID 130228136
N-(2-cyanopyrimidin-5-yl)-4,4-dimethylpentanamide (PubChem CID 130228136) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is N-(2-cyanopyrimidin-5-yl)-4,4-dimethylpentanamide.
| Compound Name | N-(2-cyanopyrimidin-5-yl)-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 130228136 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | N-(2-cyanopyrimidin-5-yl)-4,4-dimethylpentanamide |
| SMILES | CC(C)(C)CCC(=O)Nc1cnc(C#N)nc1 |
| InChI | InChI=1S/C12H16N4O/c1-12(2,3)5-4-11(17)16-9-7-14-10(6-13)15-8-9/h7-8H,4-5H2,1-3H3,(H,16,17) |
| InChIKey | VARHKJCRXGYGQT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |