C16H17F3N2O4 — CID 130229662
methyl 7-cyclopropyl-6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyrazolo[1,5-a]pyridine-3-carboxylate (PubChem CID 130229662) has the molecular formula C16H17F3N2O4 and a molecular weight of 358.32 g/mol. Its IUPAC name is methyl 7-cyclopropyl-6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyrazolo[1,5-a]pyridine-3-carboxylate.
| Compound Name | methyl 7-cyclopropyl-6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyrazolo[1,5-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 130229662 |
| Molecular Formula | C16H17F3N2O4 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | methyl 7-cyclopropyl-6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyrazolo[1,5-a]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cnn2c(C3CC3)c(OCCOCC(F)(F)F)ccc12 |
| InChI | InChI=1S/C16H17F3N2O4/c1-23-15(22)11-8-20-21-12(11)4-5-13(14(21)10-2-3-10)25-7-6-24-9-16(17,18)19/h4-5,8,10H,2-3,6-7,9H2,1H3 |
| InChIKey | OHRWCOXLMWHGIO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|