C13H13F3N2O3 — CID 118674259
1-[6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyrazolo[1,5-a]pyridin-3-yl]ethanone (PubChem CID 118674259) has the molecular formula C13H13F3N2O3 and a molecular weight of 302.25 g/mol. Its IUPAC name is 1-[6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyrazolo[1,5-a]pyridin-3-yl]ethanone.
| Compound Name | 1-[6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyrazolo[1,5-a]pyridin-3-yl]ethanone |
|---|---|
| PubChem CID | 118674259 |
| Molecular Formula | C13H13F3N2O3 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 1-[6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyrazolo[1,5-a]pyridin-3-yl]ethanone |
| SMILES | CC(=O)c1cnn2cc(OCCOCC(F)(F)F)ccc12 |
| InChI | InChI=1S/C13H13F3N2O3/c1-9(19)11-6-17-18-7-10(2-3-12(11)18)21-5-4-20-8-13(14,15)16/h2-3,6-7H,4-5,8H2,1H3 |
| InChIKey | HXYWCVKTVYZGHY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|