C12H13F3N2O2 — CID 162150186
2-methyl-6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyrazolo[1,5-a]pyridine (PubChem CID 162150186) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is 2-methyl-6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyrazolo[1,5-a]pyridine.
| Compound Name | 2-methyl-6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 162150186 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2-methyl-6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyrazolo[1,5-a]pyridine |
| SMILES | Cc1cc2ccc(OCCOCC(F)(F)F)cn2n1 |
| InChI | InChI=1S/C12H13F3N2O2/c1-9-6-10-2-3-11(7-17(10)16-9)19-5-4-18-8-12(13,14)15/h2-3,6-7H,4-5,8H2,1H3 |
| InChIKey | ZLCDYJHYIFYRQJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|