C54H37N5 — CID 130231638
2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-9H-carbazol-1-yl]-7,7-dimethyl-5-phenylindeno[2,1-b]carbazole (PubChem CID 130231638) has the molecular formula C54H37N5 and a molecular weight of 755.93 g/mol. Its IUPAC name is 2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-9H-carbazol-1-yl]-7,7-dimethyl-5-phenylindeno[2,1-b]carbazole.
| Compound Name | 2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-9H-carbazol-1-yl]-7,7-dimethyl-5-phenylindeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 130231638 |
| Molecular Formula | C54H37N5 |
| Molecular Weight | 755.93 g/mol |
| Exact Mass | 755.30 |
| IUPAC Name | 2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-9H-carbazol-1-yl]-7,7-dimethyl-5-phenylindeno[2,1-b]carbazole |
| SMILES | CC1(C)c2ccccc2-c2cc3c4cc(-c5ccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c6c5[nH]c5ccccc56)ccc4n(-c4ccccc4)c3cc21 |
| InChI | InChI=1S/C54H37N5/c1-54(2)44-24-14-12-22-38(44)41-31-43-42-30-35(26-29-47(42)59(48(43)32-45(41)54)36-20-10-5-11-21-36)37-27-28-40(49-39-23-13-15-25-46(39)55-50(37)49)53-57-51(33-16-6-3-7-17-33)56-52(58-53)34-18-8-4-9-19-34/h3-32,55H,1-2H3 |
| InChIKey | WRFMJKADVLMGKM-UHFFFAOYSA-N |
| XLogP | 13.58 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.93 |
| LogP ≤ 5 | 13.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |