C13H20N4O4 — CID 130233209
N-[2-(aminomethyl)-4-(2,4-dioxo-1H-pyrimidin-5-yl)butyl]-3-oxobutanamide (PubChem CID 130233209) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is N-[2-(aminomethyl)-4-(2,4-dioxo-1H-pyrimidin-5-yl)butyl]-3-oxobutanamide.
| Compound Name | N-[2-(aminomethyl)-4-(2,4-dioxo-1H-pyrimidin-5-yl)butyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 130233209 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N-[2-(aminomethyl)-4-(2,4-dioxo-1H-pyrimidin-5-yl)butyl]-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)NCC(CN)CCc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H20N4O4/c1-8(18)4-11(19)15-6-9(5-14)2-3-10-7-16-13(21)17-12(10)20/h7,9H,2-6,14H2,1H3,(H,15,19)(H2,16,17,20,21) |
| InChIKey | RDIUEHLKCUCODR-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 137.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|