C18H14ClIN2O2S — CID 130234908
2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-3-(4-iodophenyl)propanoic acid (PubChem CID 130234908) has the molecular formula C18H14ClIN2O2S and a molecular weight of 484.75 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-3-(4-iodophenyl)propanoic acid.
| Compound Name | 2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-3-(4-iodophenyl)propanoic acid |
|---|---|
| PubChem CID | 130234908 |
| Molecular Formula | C18H14ClIN2O2S |
| Molecular Weight | 484.75 g/mol |
| Exact Mass | 483.95 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-3-(4-iodophenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(I)cc1)Nc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C18H14ClIN2O2S/c19-13-5-3-12(4-6-13)16-10-25-18(22-16)21-15(17(23)24)9-11-1-7-14(20)8-2-11/h1-8,10,15H,9H2,(H,21,22)(H,23,24) |
| InChIKey | QSXYCZJYASQVNF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.75 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|