C19H16ClIN2O2S — CID 88947797
2-[[4-(3-chloro-4-methylphenyl)-1,3-thiazol-2-yl]amino]-3-(4-iodophenyl)propanoic acid (PubChem CID 88947797) has the molecular formula C19H16ClIN2O2S and a molecular weight of 498.77 g/mol. Its IUPAC name is 2-[[4-(3-chloro-4-methylphenyl)-1,3-thiazol-2-yl]amino]-3-(4-iodophenyl)propanoic acid.
| Compound Name | 2-[[4-(3-chloro-4-methylphenyl)-1,3-thiazol-2-yl]amino]-3-(4-iodophenyl)propanoic acid |
|---|---|
| PubChem CID | 88947797 |
| Molecular Formula | C19H16ClIN2O2S |
| Molecular Weight | 498.77 g/mol |
| Exact Mass | 497.97 |
| IUPAC Name | 2-[[4-(3-chloro-4-methylphenyl)-1,3-thiazol-2-yl]amino]-3-(4-iodophenyl)propanoic acid |
| SMILES | Cc1ccc(-c2csc(NC(Cc3ccc(I)cc3)C(=O)O)n2)cc1Cl |
| InChI | InChI=1S/C19H16ClIN2O2S/c1-11-2-5-13(9-15(11)20)17-10-26-19(23-17)22-16(18(24)25)8-12-3-6-14(21)7-4-12/h2-7,9-10,16H,8H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | BVNPHGOBRLWDDX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.77 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|