C24H17F14NO3S — CID 130237422
4-[(Z)-1,4,4,4-tetrafluoro-3-[4-fluoro-3-(trifluoromethyl)phenyl]but-1-enyl]-N-[1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 130237422) has the molecular formula C24H17F14NO3S and a molecular weight of 665.44 g/mol. Its IUPAC name is 4-[(Z)-1,4,4,4-tetrafluoro-3-[4-fluoro-3-(trifluoromethyl)phenyl]but-1-enyl]-N-[1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(Z)-1,4,4,4-tetrafluoro-3-[4-fluoro-3-(trifluoromethyl)phenyl]but-1-enyl]-N-[1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130237422 |
| Molecular Formula | C24H17F14NO3S |
| Molecular Weight | 665.44 g/mol |
| Exact Mass | 665.07 |
| IUPAC Name | 4-[(Z)-1,4,4,4-tetrafluoro-3-[4-fluoro-3-(trifluoromethyl)phenyl]but-1-enyl]-N-[1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | CC(CS(=O)(=O)CC(F)(F)F)NC(=O)c1ccc(/C(F)=C/C(c2ccc(F)c(C(F)(F)F)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C24H17F14NO3S/c1-11(9-43(41,42)10-21(27,28)29)39-20(40)14-4-2-13(7-16(14)23(33,34)35)19(26)8-15(22(30,31)32)12-3-5-18(25)17(6-12)24(36,37)38/h2-8,11,15H,9-10H2,1H3,(H,39,40)/b19-8- |
| InChIKey | NIMGWOOZGZFEOM-UWVJOHFNSA-N |
| XLogP | 7.62 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.44 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |