C31H37N3O4 — CID 130238478
tert-butyl 4-[[6-(3-methylbutyl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-17-yl]methyl]benzoate (PubChem CID 130238478) has the molecular formula C31H37N3O4 and a molecular weight of 515.65 g/mol. Its IUPAC name is tert-butyl 4-[[6-(3-methylbutyl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-17-yl]methyl]benzoate.
| Compound Name | tert-butyl 4-[[6-(3-methylbutyl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-17-yl]methyl]benzoate |
|---|---|
| PubChem CID | 130238478 |
| Molecular Formula | C31H37N3O4 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.28 |
| IUPAC Name | tert-butyl 4-[[6-(3-methylbutyl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-17-yl]methyl]benzoate |
| SMILES | CC(C)CCN1CC(=O)N2Cc3c(c4ccccc4n3Cc3ccc(C(=O)OC(C)(C)C)cc3)CC2C1=O |
| InChI | InChI=1S/C31H37N3O4/c1-20(2)14-15-32-19-28(35)34-18-27-24(16-26(34)29(32)36)23-8-6-7-9-25(23)33(27)17-21-10-12-22(13-11-21)30(37)38-31(3,4)5/h6-13,20,26H,14-19H2,1-5H3 |
| InChIKey | GYNOWBPDBJOYJQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|