C24H27FN2O3 — CID 118103551
tert-butyl 9-[(4-fluorophenyl)methyl]-3-(hydroxymethyl)-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate (PubChem CID 118103551) has the molecular formula C24H27FN2O3 and a molecular weight of 410.49 g/mol. Its IUPAC name is tert-butyl 9-[(4-fluorophenyl)methyl]-3-(hydroxymethyl)-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate.
| Compound Name | tert-butyl 9-[(4-fluorophenyl)methyl]-3-(hydroxymethyl)-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 118103551 |
| Molecular Formula | C24H27FN2O3 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | tert-butyl 9-[(4-fluorophenyl)methyl]-3-(hydroxymethyl)-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2c(c3ccccc3n2Cc2ccc(F)cc2)CC1CO |
| InChI | InChI=1S/C24H27FN2O3/c1-24(2,3)30-23(29)26-14-22-20(12-18(26)15-28)19-6-4-5-7-21(19)27(22)13-16-8-10-17(25)11-9-16/h4-11,18,28H,12-15H2,1-3H3 |
| InChIKey | CHEKPIMELLIRRP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|