C25H27FN4O3S — CID 144849215
9-[(4-fluorophenyl)methyl]-N-formyl-2-methyl-N-[3-(methylsulfanylamino)-3-oxopropyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 144849215) has the molecular formula C25H27FN4O3S and a molecular weight of 482.58 g/mol. Its IUPAC name is 9-[(4-fluorophenyl)methyl]-N-formyl-2-methyl-N-[3-(methylsulfanylamino)-3-oxopropyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | 9-[(4-fluorophenyl)methyl]-N-formyl-2-methyl-N-[3-(methylsulfanylamino)-3-oxopropyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 144849215 |
| Molecular Formula | C25H27FN4O3S |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 9-[(4-fluorophenyl)methyl]-N-formyl-2-methyl-N-[3-(methylsulfanylamino)-3-oxopropyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | CSNC(=O)CCN(C=O)C(=O)C1Cc2c(n(Cc3ccc(F)cc3)c3ccccc23)CN1C |
| InChI | InChI=1S/C25H27FN4O3S/c1-28-15-23-20(13-22(28)25(33)29(16-31)12-11-24(32)27-34-2)19-5-3-4-6-21(19)30(23)14-17-7-9-18(26)10-8-17/h3-10,16,22H,11-15H2,1-2H3,(H,27,32) |
| InChIKey | KFHROCSKRPPHQZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|