C24H23FN3NaO4 — CID 144849238
sodium 3-[[9-[(4-fluorophenyl)methyl]-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole-3-carbonyl]-formylamino]propanoate (PubChem CID 144849238) has the molecular formula C24H23FN3NaO4 and a molecular weight of 459.45 g/mol. Its IUPAC name is sodium 3-[[9-[(4-fluorophenyl)methyl]-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole-3-carbonyl]-formylamino]propanoate.
| Compound Name | sodium 3-[[9-[(4-fluorophenyl)methyl]-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole-3-carbonyl]-formylamino]propanoate |
|---|---|
| PubChem CID | 144849238 |
| Molecular Formula | C24H23FN3NaO4 |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | sodium 3-[[9-[(4-fluorophenyl)methyl]-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole-3-carbonyl]-formylamino]propanoate |
| SMILES | CN1Cc2c(c3ccccc3n2Cc2ccc(F)cc2)CC1C(=O)N(C=O)CCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C24H24FN3O4.Na/c1-26-14-22-19(12-21(26)24(32)27(15-29)11-10-23(30)31)18-4-2-3-5-20(18)28(22)13-16-6-8-17(25)9-7-16;/h2-9,15,21H,10-14H2,1H3,(H,30,31);/q;+1/p-1 |
| InChIKey | QQUNOBSGISFFFD-UHFFFAOYSA-M |
| XLogP | -1.69 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|