C19H17FN2O2 — CID 90878202
9-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylic acid (PubChem CID 90878202) has the molecular formula C19H17FN2O2 and a molecular weight of 324.36 g/mol. Its IUPAC name is 9-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylic acid.
| Compound Name | 9-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 90878202 |
| Molecular Formula | C19H17FN2O2 |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 9-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylic acid |
| SMILES | O=C(O)N1CCc2c(n(Cc3ccc(F)cc3)c3ccccc23)C1 |
| InChI | InChI=1S/C19H17FN2O2/c20-14-7-5-13(6-8-14)11-22-17-4-2-1-3-15(17)16-9-10-21(19(23)24)12-18(16)22/h1-8H,9-12H2,(H,23,24) |
| InChIKey | YHTBSTVHORQYHH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|