C16H20N2O2 — CID 175148722
5-(2-methylpropyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylic acid (PubChem CID 175148722) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 5-(2-methylpropyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylic acid.
| Compound Name | 5-(2-methylpropyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 175148722 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 5-(2-methylpropyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylic acid |
| SMILES | CC(C)Cn1c2c(c3ccccc31)CN(C(=O)O)CC2 |
| InChI | InChI=1S/C16H20N2O2/c1-11(2)9-18-14-6-4-3-5-12(14)13-10-17(16(19)20)8-7-15(13)18/h3-6,11H,7-10H2,1-2H3,(H,19,20) |
| InChIKey | YLYGFIUZMBPFMJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|