C26H26FN3O4 — CID 123337478
4-[8-[(4-fluorophenyl)methyl]-14-hydroxy-12-oxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-13-yl]-3,3-dimethylbutanoic acid (PubChem CID 123337478) has the molecular formula C26H26FN3O4 and a molecular weight of 463.51 g/mol. Its IUPAC name is 4-[8-[(4-fluorophenyl)methyl]-14-hydroxy-12-oxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-13-yl]-3,3-dimethylbutanoic acid.
| Compound Name | 4-[8-[(4-fluorophenyl)methyl]-14-hydroxy-12-oxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-13-yl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 123337478 |
| Molecular Formula | C26H26FN3O4 |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 4-[8-[(4-fluorophenyl)methyl]-14-hydroxy-12-oxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-13-yl]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)Cn1c(O)c2n(c1=O)Cc1c(c3ccccc3n1Cc1ccc(F)cc1)C2 |
| InChI | InChI=1S/C26H26FN3O4/c1-26(2,12-23(31)32)15-30-24(33)21-11-19-18-5-3-4-6-20(18)28(22(19)14-29(21)25(30)34)13-16-7-9-17(27)10-8-16/h3-10,33H,11-15H2,1-2H3,(H,31,32) |
| InChIKey | NEKAPAMKUUAFEB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|