C25H27N3O4 — CID 166835376
4-[[3-[ethyl(2-oxoethyl)carbamoyl]-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl]methyl]benzoic acid (PubChem CID 166835376) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is 4-[[3-[ethyl(2-oxoethyl)carbamoyl]-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl]methyl]benzoic acid.
| Compound Name | 4-[[3-[ethyl(2-oxoethyl)carbamoyl]-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 166835376 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 4-[[3-[ethyl(2-oxoethyl)carbamoyl]-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl]methyl]benzoic acid |
| SMILES | CCN(CC=O)C(=O)C1Cc2c(n(Cc3ccc(C(=O)O)cc3)c3ccccc23)CN1C |
| InChI | InChI=1S/C25H27N3O4/c1-3-27(12-13-29)24(30)22-14-20-19-6-4-5-7-21(19)28(23(20)16-26(22)2)15-17-8-10-18(11-9-17)25(31)32/h4-11,13,22H,3,12,14-16H2,1-2H3,(H,31,32) |
| InChIKey | UAJBBXUXJAHFKU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|