C23H19FN4O — CID 118103447
2-[8-[(4-fluorophenyl)methyl]-14-methylidene-12-oxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]acetonitrile (PubChem CID 118103447) has the molecular formula C23H19FN4O and a molecular weight of 386.43 g/mol. Its IUPAC name is 2-[8-[(4-fluorophenyl)methyl]-14-methylidene-12-oxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]acetonitrile.
| Compound Name | 2-[8-[(4-fluorophenyl)methyl]-14-methylidene-12-oxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]acetonitrile |
|---|---|
| PubChem CID | 118103447 |
| Molecular Formula | C23H19FN4O |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-[8-[(4-fluorophenyl)methyl]-14-methylidene-12-oxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]acetonitrile |
| SMILES | C=C1C2Cc3c(n(Cc4ccc(F)cc4)c4ccccc34)CN2C(=O)N1CC#N |
| InChI | InChI=1S/C23H19FN4O/c1-15-21-12-19-18-4-2-3-5-20(18)27(13-16-6-8-17(24)9-7-16)22(19)14-28(21)23(29)26(15)11-10-25/h2-9,21H,1,11-14H2 |
| InChIKey | HBIYHCHBCNBIBC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 52.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|