C27H32O6 — CID 130238686
[1-(furan-2-yl)-3-[5-(1-prop-2-enoyloxycyclohexyl)furan-2-yl]cyclohexyl] 2-methylprop-2-enoate (PubChem CID 130238686) has the molecular formula C27H32O6 and a molecular weight of 452.55 g/mol. Its IUPAC name is [1-(furan-2-yl)-3-[5-(1-prop-2-enoyloxycyclohexyl)furan-2-yl]cyclohexyl] 2-methylprop-2-enoate.
| Compound Name | [1-(furan-2-yl)-3-[5-(1-prop-2-enoyloxycyclohexyl)furan-2-yl]cyclohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 130238686 |
| Molecular Formula | C27H32O6 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | [1-(furan-2-yl)-3-[5-(1-prop-2-enoyloxycyclohexyl)furan-2-yl]cyclohexyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OC1(c2ccc(C3CCCC(OC(=O)C(=C)C)(c4ccco4)C3)o2)CCCCC1 |
| InChI | InChI=1S/C27H32O6/c1-4-24(28)32-26(14-6-5-7-15-26)23-13-12-21(31-23)20-10-8-16-27(18-20,22-11-9-17-30-22)33-25(29)19(2)3/h4,9,11-13,17,20H,1-2,5-8,10,14-16,18H2,3H3 |
| InChIKey | GMQIZBWGEBBVPK-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 78.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|