C17H32N2 — CID 130238698
1-(2-methyl-2-piperidin-1-ylpropyl)-4-propan-2-yl-3,6-dihydro-2H-pyridine (PubChem CID 130238698) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is 1-(2-methyl-2-piperidin-1-ylpropyl)-4-propan-2-yl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(2-methyl-2-piperidin-1-ylpropyl)-4-propan-2-yl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 130238698 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | 1-(2-methyl-2-piperidin-1-ylpropyl)-4-propan-2-yl-3,6-dihydro-2H-pyridine |
| SMILES | CC(C)C1=CCN(CC(C)(C)N2CCCCC2)CC1 |
| InChI | InChI=1S/C17H32N2/c1-15(2)16-8-12-18(13-9-16)14-17(3,4)19-10-6-5-7-11-19/h8,15H,5-7,9-14H2,1-4H3 |
| InChIKey | HGNCFLBDXCKYBK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|